About 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline
8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline (PubChem CID 158822791) has the molecular formula C20H13BrCl4N2O2
and a molecular weight of 535.05 g/mol. Its IUPAC name is 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline.
Molecular Properties
| Compound Name | 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline |
| PubChem CID | 158822791 |
| Molecular Formula | C20H13BrCl4N2O2 |
| Molecular Weight | 535.05 g/mol |
| Exact Mass | 531.89 |
| IUPAC Name | 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline |
| SMILES | COc1ccc(Br)c2nc(Cl)cc(Cl)c12.COc1cccc2nc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C10H6BrCl2NO.C10H7Cl2NO/c1-15-7-3-2-5(11)10-9(7)6(12)4-8(13)14-10;1-14-8-4-2-3-7-10(8)6(11)5-9(12)13-7/h2-4H,1H3;2-5H,1H3 |
| InChIKey | IWBSHEHPJVUUGL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.05 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline?
The IUPAC name of 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline (CID 158822791) is 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline.
What is the SMILES notation for 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline?
The canonical SMILES for 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline is COc1ccc(Br)c2nc(Cl)cc(Cl)c12.COc1cccc2nc(Cl)cc(Cl)c12.
What is the InChIKey of 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline?
The InChIKey is IWBSHEHPJVUUGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrCl2NO.C10H7Cl2NO/c1-15-7-3-2-5(11)10-9(7)6(12)4-8(13)14-10;1-14-8-4-2-3-7-10(8)6(11)5-9(12)13-7/h2-4H,1H3;2-5H,1H3.
What are the key properties of 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline?
8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline has a molecular weight of 535.05 g/mol, XLogP of 7.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,4-dichloro-5-methoxyquinoline;2,4-dichloro-5-methoxyquinoline is sourced from PubChem (CID 158822791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).