C12H12F3N3O2 — CID 62251152
[5,8-dimethoxy-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 62251152) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is [5,8-dimethoxy-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
| Compound Name | [5,8-dimethoxy-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62251152 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [5,8-dimethoxy-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | COc1ccc(OC)c2c(NN)cc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C12H12F3N3O2/c1-19-7-3-4-8(20-2)11-10(7)6(18-16)5-9(17-11)12(13,14)15/h3-5H,16H2,1-2H3,(H,17,18) |
| InChIKey | GQOXOIKSDJWOMR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|