C13H14ClF3N2O2 — CID 54606634
5,8-dimethoxy-4-methyl-2-(trifluoromethyl)quinolin-6-amine;hydrochloride (PubChem CID 54606634) has the molecular formula C13H14ClF3N2O2 and a molecular weight of 322.71 g/mol. Its IUPAC name is 5,8-dimethoxy-4-methyl-2-(trifluoromethyl)quinolin-6-amine;hydrochloride.
| Compound Name | 5,8-dimethoxy-4-methyl-2-(trifluoromethyl)quinolin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 54606634 |
| Molecular Formula | C13H14ClF3N2O2 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 5,8-dimethoxy-4-methyl-2-(trifluoromethyl)quinolin-6-amine;hydrochloride |
| SMILES | COc1cc(N)c(OC)c2c(C)cc(C(F)(F)F)nc12.Cl |
| InChI | InChI=1S/C13H13F3N2O2.ClH/c1-6-4-9(13(14,15)16)18-11-8(19-2)5-7(17)12(20-3)10(6)11;/h4-5H,17H2,1-3H3;1H |
| InChIKey | GZMJCCPATXPLPB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|