C11H7Cl2F3N2 — CID 113445976
5,8-dichloro-6-methyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 113445976) has the molecular formula C11H7Cl2F3N2 and a molecular weight of 295.09 g/mol. Its IUPAC name is 5,8-dichloro-6-methyl-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 5,8-dichloro-6-methyl-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 113445976 |
| Molecular Formula | C11H7Cl2F3N2 |
| Molecular Weight | 295.09 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 5,8-dichloro-6-methyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | Cc1cc(Cl)c2nc(C(F)(F)F)cc(N)c2c1Cl |
| InChI | InChI=1S/C11H7Cl2F3N2/c1-4-2-5(12)10-8(9(4)13)6(17)3-7(18-10)11(14,15)16/h2-3H,1H3,(H2,17,18) |
| InChIKey | UXUORVLATILSPT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.09 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |