C12H9ClF3N — CID 43668724
4-chloro-5,8-dimethyl-2-(trifluoromethyl)quinoline (PubChem CID 43668724) has the molecular formula C12H9ClF3N and a molecular weight of 259.66 g/mol. Its IUPAC name is 4-chloro-5,8-dimethyl-2-(trifluoromethyl)quinoline.
| Compound Name | 4-chloro-5,8-dimethyl-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 43668724 |
| Molecular Formula | C12H9ClF3N |
| Molecular Weight | 259.66 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 4-chloro-5,8-dimethyl-2-(trifluoromethyl)quinoline |
| SMILES | Cc1ccc(C)c2c(Cl)cc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C12H9ClF3N/c1-6-3-4-7(2)11-10(6)8(13)5-9(17-11)12(14,15)16/h3-5H,1-2H3 |
| InChIKey | SYGLXPYNUJXSHR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |