C10H2ClF6N — CID 62811306
4-chloro-5,6,8-trifluoro-2-(trifluoromethyl)quinoline (PubChem CID 62811306) has the molecular formula C10H2ClF6N and a molecular weight of 285.57 g/mol. Its IUPAC name is 4-chloro-5,6,8-trifluoro-2-(trifluoromethyl)quinoline.
| Compound Name | 4-chloro-5,6,8-trifluoro-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 62811306 |
| Molecular Formula | C10H2ClF6N |
| Molecular Weight | 285.57 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 4-chloro-5,6,8-trifluoro-2-(trifluoromethyl)quinoline |
| SMILES | Fc1cc(F)c2nc(C(F)(F)F)cc(Cl)c2c1F |
| InChI | InChI=1S/C10H2ClF6N/c11-3-1-6(10(15,16)17)18-9-5(13)2-4(12)8(14)7(3)9/h1-2H |
| InChIKey | HXXFWGQQSOXSPW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|