C11H6F6N2 — CID 62810601
5,6,8-trifluoro-N-methyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 62810601) has the molecular formula C11H6F6N2 and a molecular weight of 280.17 g/mol. Its IUPAC name is 5,6,8-trifluoro-N-methyl-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 5,6,8-trifluoro-N-methyl-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 62810601 |
| Molecular Formula | C11H6F6N2 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 5,6,8-trifluoro-N-methyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | CNc1cc(C(F)(F)F)nc2c(F)cc(F)c(F)c12 |
| InChI | InChI=1S/C11H6F6N2/c1-18-6-3-7(11(15,16)17)19-10-5(13)2-4(12)9(14)8(6)10/h2-3H,1H3,(H,18,19) |
| InChIKey | YTJUXMVUQBQHSV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|