C14H15BrF2N2 — CID 102854976
5-bromo-2-tert-butyl-6,8-difluoro-N-methylquinolin-4-amine (PubChem CID 102854976) has the molecular formula C14H15BrF2N2 and a molecular weight of 329.19 g/mol. Its IUPAC name is 5-bromo-2-tert-butyl-6,8-difluoro-N-methylquinolin-4-amine.
| Compound Name | 5-bromo-2-tert-butyl-6,8-difluoro-N-methylquinolin-4-amine |
|---|---|
| PubChem CID | 102854976 |
| Molecular Formula | C14H15BrF2N2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 5-bromo-2-tert-butyl-6,8-difluoro-N-methylquinolin-4-amine |
| SMILES | CNc1cc(C(C)(C)C)nc2c(F)cc(F)c(Br)c12 |
| InChI | InChI=1S/C14H15BrF2N2/c1-14(2,3)10-6-9(18-4)11-12(15)7(16)5-8(17)13(11)19-10/h5-6H,1-4H3,(H,18,19) |
| InChIKey | ZXOBETJPXLTWNG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|