C10H2BrClF5N — CID 102854746
5-bromo-4-chloro-6,8-difluoro-2-(trifluoromethyl)quinoline (PubChem CID 102854746) has the molecular formula C10H2BrClF5N and a molecular weight of 346.48 g/mol. Its IUPAC name is 5-bromo-4-chloro-6,8-difluoro-2-(trifluoromethyl)quinoline.
| Compound Name | 5-bromo-4-chloro-6,8-difluoro-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 102854746 |
| Molecular Formula | C10H2BrClF5N |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 344.90 |
| IUPAC Name | 5-bromo-4-chloro-6,8-difluoro-2-(trifluoromethyl)quinoline |
| SMILES | Fc1cc(F)c2nc(C(F)(F)F)cc(Cl)c2c1Br |
| InChI | InChI=1S/C10H2BrClF5N/c11-8-4(13)2-5(14)9-7(8)3(12)1-6(18-9)10(15,16)17/h1-2H |
| InChIKey | OBBXCWZKOUKCRU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|