C10H2BrCl3F3N — CID 107792857
6-bromo-4,7,8-trichloro-2-(trifluoromethyl)quinoline (PubChem CID 107792857) has the molecular formula C10H2BrCl3F3N and a molecular weight of 379.39 g/mol. Its IUPAC name is 6-bromo-4,7,8-trichloro-2-(trifluoromethyl)quinoline.
| Compound Name | 6-bromo-4,7,8-trichloro-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 107792857 |
| Molecular Formula | C10H2BrCl3F3N |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 376.84 |
| IUPAC Name | 6-bromo-4,7,8-trichloro-2-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cc(Cl)c2cc(Br)c(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C10H2BrCl3F3N/c11-4-1-3-5(12)2-6(10(15,16)17)18-9(3)8(14)7(4)13/h1-2H |
| InChIKey | VBFGFHCBFHEBFO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|