About 6-bromo-4,7,8-trichloro-2-methylquinoline
6-bromo-4,7,8-trichloro-2-methylquinoline (PubChem CID 107792863) has the molecular formula C10H5BrCl3N
and a molecular weight of 325.42 g/mol. Its IUPAC name is 6-bromo-4,7,8-trichloro-2-methylquinoline.
Molecular Properties
| Compound Name | 6-bromo-4,7,8-trichloro-2-methylquinoline |
| PubChem CID | 107792863 |
| Molecular Formula | C10H5BrCl3N |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 322.87 |
| IUPAC Name | 6-bromo-4,7,8-trichloro-2-methylquinoline |
| SMILES | Cc1cc(Cl)c2cc(Br)c(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C10H5BrCl3N/c1-4-2-7(12)5-3-6(11)8(13)9(14)10(5)15-4/h2-3H,1H3 |
| InChIKey | VQGLFNXTXACJPI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4,7,8-trichloro-2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,7,8-trichloro-2-methylquinoline?
The IUPAC name of 6-bromo-4,7,8-trichloro-2-methylquinoline (CID 107792863) is 6-bromo-4,7,8-trichloro-2-methylquinoline.
What is the SMILES notation for 6-bromo-4,7,8-trichloro-2-methylquinoline?
The canonical SMILES for 6-bromo-4,7,8-trichloro-2-methylquinoline is Cc1cc(Cl)c2cc(Br)c(Cl)c(Cl)c2n1.
What is the InChIKey of 6-bromo-4,7,8-trichloro-2-methylquinoline?
The InChIKey is VQGLFNXTXACJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrCl3N/c1-4-2-7(12)5-3-6(11)8(13)9(14)10(5)15-4/h2-3H,1H3.
What are the key properties of 6-bromo-4,7,8-trichloro-2-methylquinoline?
6-bromo-4,7,8-trichloro-2-methylquinoline has a molecular weight of 325.42 g/mol, XLogP of 5.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,7,8-trichloro-2-methylquinoline is sourced from PubChem (CID 107792863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).