C11H10BrCl2N3O — CID 107794014
[6-bromo-7,8-dichloro-2-(methoxymethyl)quinolin-4-yl]hydrazine (PubChem CID 107794014) has the molecular formula C11H10BrCl2N3O and a molecular weight of 351.03 g/mol. Its IUPAC name is [6-bromo-7,8-dichloro-2-(methoxymethyl)quinolin-4-yl]hydrazine.
| Compound Name | [6-bromo-7,8-dichloro-2-(methoxymethyl)quinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 107794014 |
| Molecular Formula | C11H10BrCl2N3O |
| Molecular Weight | 351.03 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | [6-bromo-7,8-dichloro-2-(methoxymethyl)quinolin-4-yl]hydrazine |
| SMILES | COCc1cc(NN)c2cc(Br)c(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C11H10BrCl2N3O/c1-18-4-5-2-8(17-15)6-3-7(12)9(13)10(14)11(6)16-5/h2-3H,4,15H2,1H3,(H,16,17) |
| InChIKey | BGSMXMYMOKGPON-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.03 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|