C14H15BrCl2N2 — CID 107793852
6-bromo-7,8-dichloro-2,3-dimethyl-N-propylquinolin-4-amine (PubChem CID 107793852) has the molecular formula C14H15BrCl2N2 and a molecular weight of 362.10 g/mol. Its IUPAC name is 6-bromo-7,8-dichloro-2,3-dimethyl-N-propylquinolin-4-amine.
| Compound Name | 6-bromo-7,8-dichloro-2,3-dimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 107793852 |
| Molecular Formula | C14H15BrCl2N2 |
| Molecular Weight | 362.10 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 6-bromo-7,8-dichloro-2,3-dimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C)c(C)nc2c(Cl)c(Cl)c(Br)cc12 |
| InChI | InChI=1S/C14H15BrCl2N2/c1-4-5-18-13-7(2)8(3)19-14-9(13)6-10(15)11(16)12(14)17/h6H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | XHFCAGDNBYVFFM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.10 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|