C18H26N2 — CID 63481112
6-tert-butyl-2,3-dimethyl-N-propylquinolin-4-amine (PubChem CID 63481112) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 6-tert-butyl-2,3-dimethyl-N-propylquinolin-4-amine.
| Compound Name | 6-tert-butyl-2,3-dimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63481112 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 6-tert-butyl-2,3-dimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C)c(C)nc2ccc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C18H26N2/c1-7-10-19-17-12(2)13(3)20-16-9-8-14(11-15(16)17)18(4,5)6/h8-9,11H,7,10H2,1-6H3,(H,19,20) |
| InChIKey | VANNTPAVDCGHSJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |