C20H28N2O4S2 — CID 139794164
7-[1,1-bis(methylsulfonyl)ethyl]-N-propyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 139794164) has the molecular formula C20H28N2O4S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 7-[1,1-bis(methylsulfonyl)ethyl]-N-propyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-[1,1-bis(methylsulfonyl)ethyl]-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 139794164 |
| Molecular Formula | C20H28N2O4S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 7-[1,1-bis(methylsulfonyl)ethyl]-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCCNc1c2c(nc3ccc(C(C)(S(C)(=O)=O)S(C)(=O)=O)cc13)CCCC2 |
| InChI | InChI=1S/C20H28N2O4S2/c1-5-12-21-19-15-8-6-7-9-17(15)22-18-11-10-14(13-16(18)19)20(2,27(3,23)24)28(4,25)26/h10-11,13H,5-9,12H2,1-4H3,(H,21,22) |
| InChIKey | WUMFBVHTBHGJHN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |