C25H42N3O5P — CID 54601219
N',N'-dibutyl-N-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine;phosphoric acid (PubChem CID 54601219) has the molecular formula C25H42N3O5P and a molecular weight of 495.60 g/mol. Its IUPAC name is N',N'-dibutyl-N-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine;phosphoric acid.
| Compound Name | N',N'-dibutyl-N-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine;phosphoric acid |
|---|---|
| PubChem CID | 54601219 |
| Molecular Formula | C25H42N3O5P |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N',N'-dibutyl-N-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine;phosphoric acid |
| SMILES | CCCCN(CCCC)CCCNc1c2c(nc3ccc(OC)cc13)CCCC2.O=P(O)(O)O |
| InChI | InChI=1S/C25H39N3O.H3O4P/c1-4-6-16-28(17-7-5-2)18-10-15-26-25-21-11-8-9-12-23(21)27-24-14-13-20(29-3)19-22(24)25;1-5(2,3)4/h13-14,19H,4-12,15-18H2,1-3H3,(H,26,27);(H3,1,2,3,4) |
| InChIKey | LCPMCWVPGOTUKR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|