C26H25N3O4 — CID 118721628
5-hydroxy-2-[2-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]naphthalene-1,4-dione (PubChem CID 118721628) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 5-hydroxy-2-[2-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]naphthalene-1,4-dione.
| Compound Name | 5-hydroxy-2-[2-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 118721628 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 5-hydroxy-2-[2-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]naphthalene-1,4-dione |
| SMILES | COc1ccc2nc3c(c(NCCNC4=CC(=O)c5c(O)cccc5C4=O)c2c1)CCCC3 |
| InChI | InChI=1S/C26H25N3O4/c1-33-15-9-10-20-18(13-15)25(16-5-2-3-7-19(16)29-20)28-12-11-27-21-14-23(31)24-17(26(21)32)6-4-8-22(24)30/h4,6,8-10,13-14,27,30H,2-3,5,7,11-12H2,1H3,(H,28,29) |
| InChIKey | NUIGMEAFRDCLAO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|