2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid

C16H17NO3 — CID 82452003

IUPAC2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid
SMILESCOc1ccc2nc3c(c(CC(=O)O)c2c1)CCCC3
InChIInChI=1S/C16H17NO3/c1-20-10-6-7-15-13(8-10)12(9-16(18)19)11-4-2-3-5-14(11)17-15/h6-8H,2-5,9H2,1H3,(H,18,19)
InChIKeyAFMATZNXVZFLTR-UHFFFAOYSA-N
MW271.32 g/mol
LogP2.75
Rot. Bonds3

About 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid

2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid (PubChem CID 82452003) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid.

Molecular Properties

Compound Name2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid
PubChem CID82452003
Molecular FormulaC16H17NO3
Molecular Weight271.32 g/mol
Exact Mass271.12
IUPAC Name2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid
SMILESCOc1ccc2nc3c(c(CC(=O)O)c2c1)CCCC3
InChIInChI=1S/C16H17NO3/c1-20-10-6-7-15-13(8-10)12(9-16(18)19)11-4-2-3-5-14(11)17-15/h6-8H,2-5,9H2,1H3,(H,18,19)
InChIKeyAFMATZNXVZFLTR-UHFFFAOYSA-N
XLogP2.75
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.32
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid?
The IUPAC name of 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid (CID 82452003) is 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid.
What is the SMILES notation for 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid?
The canonical SMILES for 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid is COc1ccc2nc3c(c(CC(=O)O)c2c1)CCCC3.
What is the InChIKey of 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid?
The InChIKey is AFMATZNXVZFLTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-20-10-6-7-15-13(8-10)12(9-16(18)19)11-4-2-3-5-14(11)17-15/h6-8H,2-5,9H2,1H3,(H,18,19).
What are the key properties of 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid?
2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid has a molecular weight of 271.32 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)acetic acid is sourced from PubChem (CID 82452003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).