C14H15NOS — CID 82451972
(7-methoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol (PubChem CID 82451972) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is (7-methoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol.
| Compound Name | (7-methoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol |
|---|---|
| PubChem CID | 82451972 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (7-methoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol |
| SMILES | COc1ccc2nc3c(c(CS)c2c1)CCC3 |
| InChI | InChI=1S/C14H15NOS/c1-16-9-5-6-14-11(7-9)12(8-17)10-3-2-4-13(10)15-14/h5-7,17H,2-4,8H2,1H3 |
| InChIKey | HBOCXANQRQXUIW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|