3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid

C17H19NO3 — CID 82452010

IUPAC3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid
SMILESCOc1ccc2nc3c(c(CCC(=O)O)c2c1)CCCC3
InChIInChI=1S/C17H19NO3/c1-21-11-6-8-16-14(10-11)12(7-9-17(19)20)13-4-2-3-5-15(13)18-16/h6,8,10H,2-5,7,9H2,1H3,(H,19,20)
InChIKeyQDGLXBBNZHTISD-UHFFFAOYSA-N
MW285.34 g/mol
LogP3.14
Rot. Bonds4

About 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid

3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid (PubChem CID 82452010) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid.

Molecular Properties

Compound Name3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid
PubChem CID82452010
Molecular FormulaC17H19NO3
Molecular Weight285.34 g/mol
Exact Mass285.14
IUPAC Name3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid
SMILESCOc1ccc2nc3c(c(CCC(=O)O)c2c1)CCCC3
InChIInChI=1S/C17H19NO3/c1-21-11-6-8-16-14(10-11)12(7-9-17(19)20)13-4-2-3-5-15(13)18-16/h6,8,10H,2-5,7,9H2,1H3,(H,19,20)
InChIKeyQDGLXBBNZHTISD-UHFFFAOYSA-N
XLogP3.14
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.34
LogP ≤ 53.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid?
The IUPAC name of 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid (CID 82452010) is 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid.
What is the SMILES notation for 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid?
The canonical SMILES for 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid is COc1ccc2nc3c(c(CCC(=O)O)c2c1)CCCC3.
What is the InChIKey of 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid?
The InChIKey is QDGLXBBNZHTISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-21-11-6-8-16-14(10-11)12(7-9-17(19)20)13-4-2-3-5-15(13)18-16/h6,8,10H,2-5,7,9H2,1H3,(H,19,20).
What are the key properties of 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid?
3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid has a molecular weight of 285.34 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)propanoic acid is sourced from PubChem (CID 82452010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).