C33H43N5O2 — CID 155562267
(2S)-2-amino-3-(1H-indol-3-yl)-N-[8-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]propanamide (PubChem CID 155562267) has the molecular formula C33H43N5O2 and a molecular weight of 541.74 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)-N-[8-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]propanamide.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[8-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]propanamide |
|---|---|
| PubChem CID | 155562267 |
| Molecular Formula | C33H43N5O2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[8-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]propanamide |
| SMILES | COc1ccc2nc3c(c(NCCCCCCCCNC(=O)[C@@H](N)Cc4c[nH]c5ccccc45)c2c1)CCCC3 |
| InChI | InChI=1S/C33H43N5O2/c1-40-24-16-17-31-27(21-24)32(26-13-7-9-15-30(26)38-31)35-18-10-4-2-3-5-11-19-36-33(39)28(34)20-23-22-37-29-14-8-6-12-25(23)29/h6,8,12,14,16-17,21-22,28,37H,2-5,7,9-11,13,15,18-20,34H2,1H3,(H,35,38)(H,36,39)/t28-/m0/s1 |
| InChIKey | BMKLRTWRKHBPOD-NDEPHWFRSA-N |
| XLogP | 6.04 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|