C28H34Cl3N5O — CID 155554767
(2S)-2-amino-N-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-3-(1H-indol-3-yl)propanamide;dihydrochloride (PubChem CID 155554767) has the molecular formula C28H34Cl3N5O and a molecular weight of 562.97 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-3-(1H-indol-3-yl)propanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-3-(1H-indol-3-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 155554767 |
| Molecular Formula | C28H34Cl3N5O |
| Molecular Weight | 562.97 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (2S)-2-amino-N-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butyl]-3-(1H-indol-3-yl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C28H32ClN5O.2ClH/c29-19-11-12-22-26(16-19)34-25-10-4-2-8-21(25)27(22)31-13-5-6-14-32-28(35)23(30)15-18-17-33-24-9-3-1-7-20(18)24;;/h1,3,7,9,11-12,16-17,23,33H,2,4-6,8,10,13-15,30H2,(H,31,34)(H,32,35);2*1H/t23-;;/m0../s1 |
| InChIKey | QFAMIFGKRGUSHP-IFUPQEAVSA-N |
| XLogP | 5.97 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.97 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|