C16H17BrCl2N2 — CID 107793865
7-bromo-5,6-dichloro-N-propyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 107793865) has the molecular formula C16H17BrCl2N2 and a molecular weight of 388.14 g/mol. Its IUPAC name is 7-bromo-5,6-dichloro-N-propyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-bromo-5,6-dichloro-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 107793865 |
| Molecular Formula | C16H17BrCl2N2 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 7-bromo-5,6-dichloro-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCCNc1c2c(nc3c(Cl)c(Cl)c(Br)cc13)CCCC2 |
| InChI | InChI=1S/C16H17BrCl2N2/c1-2-7-20-15-9-5-3-4-6-12(9)21-16-10(15)8-11(17)13(18)14(16)19/h8H,2-7H2,1H3,(H,20,21) |
| InChIKey | BKPLIJSUCLWZFC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|