C17H21FN2O — CID 63482755
7-fluoro-5-methoxy-N-propyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 63482755) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 7-fluoro-5-methoxy-N-propyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-fluoro-5-methoxy-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 63482755 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 7-fluoro-5-methoxy-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCCNc1c2c(nc3c(OC)cc(F)cc13)CCCC2 |
| InChI | InChI=1S/C17H21FN2O/c1-3-8-19-16-12-6-4-5-7-14(12)20-17-13(16)9-11(18)10-15(17)21-2/h9-10H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | ATNKPLGEKNEANN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |