C18H24N2 — CID 63479127
5,8-dimethyl-N-propyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 63479127) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 5,8-dimethyl-N-propyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 5,8-dimethyl-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 63479127 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 5,8-dimethyl-N-propyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCCNc1c2c(nc3c(C)ccc(C)c13)CCCC2 |
| InChI | InChI=1S/C18H24N2/c1-4-11-19-18-14-7-5-6-8-15(14)20-17-13(3)10-9-12(2)16(17)18/h9-10H,4-8,11H2,1-3H3,(H,19,20) |
| InChIKey | MJNTZJZBEWAORE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |