C11H7BrCl2F2N2 — CID 114002166
6-bromo-7,8-dichloro-2-(difluoromethyl)-N-methylquinolin-4-amine (PubChem CID 114002166) has the molecular formula C11H7BrCl2F2N2 and a molecular weight of 356.00 g/mol. Its IUPAC name is 6-bromo-7,8-dichloro-2-(difluoromethyl)-N-methylquinolin-4-amine.
| Compound Name | 6-bromo-7,8-dichloro-2-(difluoromethyl)-N-methylquinolin-4-amine |
|---|---|
| PubChem CID | 114002166 |
| Molecular Formula | C11H7BrCl2F2N2 |
| Molecular Weight | 356.00 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | 6-bromo-7,8-dichloro-2-(difluoromethyl)-N-methylquinolin-4-amine |
| SMILES | CNc1cc(C(F)F)nc2c(Cl)c(Cl)c(Br)cc12 |
| InChI | InChI=1S/C11H7BrCl2F2N2/c1-17-6-3-7(11(15)16)18-10-4(6)2-5(12)8(13)9(10)14/h2-3,11H,1H3,(H,17,18) |
| InChIKey | YBRSCUWKCNQQSO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.00 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|