C11H10BrF2N3 — CID 107629088
[7-bromo-2-(difluoromethyl)-8-methylquinolin-4-yl]hydrazine (PubChem CID 107629088) has the molecular formula C11H10BrF2N3 and a molecular weight of 302.12 g/mol. Its IUPAC name is [7-bromo-2-(difluoromethyl)-8-methylquinolin-4-yl]hydrazine.
| Compound Name | [7-bromo-2-(difluoromethyl)-8-methylquinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 107629088 |
| Molecular Formula | C11H10BrF2N3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | [7-bromo-2-(difluoromethyl)-8-methylquinolin-4-yl]hydrazine |
| SMILES | Cc1c(Br)ccc2c(NN)cc(C(F)F)nc12 |
| InChI | InChI=1S/C11H10BrF2N3/c1-5-7(12)3-2-6-8(17-15)4-9(11(13)14)16-10(5)6/h2-4,11H,15H2,1H3,(H,16,17) |
| InChIKey | XZBITTVOASTMPS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|