C11H9BrF3N3 — CID 107629093
[7-bromo-8-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 107629093) has the molecular formula C11H9BrF3N3 and a molecular weight of 320.11 g/mol. Its IUPAC name is [7-bromo-8-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
| Compound Name | [7-bromo-8-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 107629093 |
| Molecular Formula | C11H9BrF3N3 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | [7-bromo-8-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | Cc1c(Br)ccc2c(NN)cc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C11H9BrF3N3/c1-5-7(12)3-2-6-8(18-16)4-9(11(13,14)15)17-10(5)6/h2-4H,16H2,1H3,(H,17,18) |
| InChIKey | JGEONOCHANMMPB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|