C12H13F2N3O2 — CID 62892113
[2-(difluoromethyl)-5,8-dimethoxyquinolin-4-yl]hydrazine (PubChem CID 62892113) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is [2-(difluoromethyl)-5,8-dimethoxyquinolin-4-yl]hydrazine.
| Compound Name | [2-(difluoromethyl)-5,8-dimethoxyquinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62892113 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [2-(difluoromethyl)-5,8-dimethoxyquinolin-4-yl]hydrazine |
| SMILES | COc1ccc(OC)c2c(NN)cc(C(F)F)nc12 |
| InChI | InChI=1S/C12H13F2N3O2/c1-18-8-3-4-9(19-2)11-10(8)6(17-15)5-7(16-11)12(13)14/h3-5,12H,15H2,1-2H3,(H,16,17) |
| InChIKey | FJJRYAAQCQIZDE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|