C14H17F2N3O2 — CID 62892643
[2-(difluoromethyl)-5,8-diethoxyquinolin-4-yl]hydrazine (PubChem CID 62892643) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is [2-(difluoromethyl)-5,8-diethoxyquinolin-4-yl]hydrazine.
| Compound Name | [2-(difluoromethyl)-5,8-diethoxyquinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62892643 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [2-(difluoromethyl)-5,8-diethoxyquinolin-4-yl]hydrazine |
| SMILES | CCOc1ccc(OCC)c2c(NN)cc(C(F)F)nc12 |
| InChI | InChI=1S/C14H17F2N3O2/c1-3-20-10-5-6-11(21-4-2)13-12(10)8(19-17)7-9(18-13)14(15)16/h5-7,14H,3-4,17H2,1-2H3,(H,18,19) |
| InChIKey | MSUNTCLEBMGYSX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|