About (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine
(5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine (PubChem CID 62250401) has the molecular formula C14H18ClN3O2
and a molecular weight of 295.77 g/mol. Its IUPAC name is (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine |
| PubChem CID | 62250401 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine |
| SMILES | COc1cc(OC)c2nc(C(C)C)cc(NN)c2c1Cl |
| InChI | InChI=1S/C14H18ClN3O2/c1-7(2)8-5-9(18-16)12-13(15)10(19-3)6-11(20-4)14(12)17-8/h5-7H,16H2,1-4H3,(H,17,18) |
| InChIKey | RQAACOAEYHJHFU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine?
The IUPAC name of (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine (CID 62250401) is (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine.
What is the SMILES notation for (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine?
The canonical SMILES for (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine is COc1cc(OC)c2nc(C(C)C)cc(NN)c2c1Cl.
What is the InChIKey of (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine?
The InChIKey is RQAACOAEYHJHFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3O2/c1-7(2)8-5-9(18-16)12-13(15)10(19-3)6-11(20-4)14(12)17-8/h5-7H,16H2,1-4H3,(H,17,18).
What are the key properties of (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine?
(5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine has a molecular weight of 295.77 g/mol, XLogP of 3.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-6,8-dimethoxy-2-propan-2-ylquinolin-4-yl)hydrazine is sourced from PubChem (CID 62250401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).