C13H14F2N4O2 — CID 19621434
[4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)pyrimidin-2-yl]hydrazine (PubChem CID 19621434) has the molecular formula C13H14F2N4O2 and a molecular weight of 296.28 g/mol. Its IUPAC name is [4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 19621434 |
| Molecular Formula | C13H14F2N4O2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [4-(difluoromethyl)-6-(3,4-dimethoxyphenyl)pyrimidin-2-yl]hydrazine |
| SMILES | COc1ccc(-c2cc(C(F)F)nc(NN)n2)cc1OC |
| InChI | InChI=1S/C13H14F2N4O2/c1-20-10-4-3-7(5-11(10)21-2)8-6-9(12(14)15)18-13(17-8)19-16/h3-6,12H,16H2,1-2H3,(H,17,18,19) |
| InChIKey | TYRXLDPPUATSMA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|