C12H8BrF5N2 — CID 102854998
5-bromo-6,8-difluoro-N,3-dimethyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 102854998) has the molecular formula C12H8BrF5N2 and a molecular weight of 355.10 g/mol. Its IUPAC name is 5-bromo-6,8-difluoro-N,3-dimethyl-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 5-bromo-6,8-difluoro-N,3-dimethyl-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 102854998 |
| Molecular Formula | C12H8BrF5N2 |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 5-bromo-6,8-difluoro-N,3-dimethyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | CNc1c(C)c(C(F)(F)F)nc2c(F)cc(F)c(Br)c12 |
| InChI | InChI=1S/C12H8BrF5N2/c1-4-9(19-2)7-8(13)5(14)3-6(15)10(7)20-11(4)12(16,17)18/h3H,1-2H3,(H,19,20) |
| InChIKey | NEWVEBJOGHWTHJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|