About 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline
4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline (PubChem CID 63743382) has the molecular formula C11H5ClF5N
and a molecular weight of 281.61 g/mol. Its IUPAC name is 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline |
| PubChem CID | 63743382 |
| Molecular Formula | C11H5ClF5N |
| Molecular Weight | 281.61 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline |
| SMILES | Cc1c(C(F)(F)F)nc2c(F)cc(F)cc2c1Cl |
| InChI | InChI=1S/C11H5ClF5N/c1-4-8(12)6-2-5(13)3-7(14)9(6)18-10(4)11(15,16)17/h2-3H,1H3 |
| InChIKey | HZRPNWIGHHLMDH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline?
The IUPAC name of 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline (CID 63743382) is 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline.
What is the SMILES notation for 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline?
The canonical SMILES for 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline is Cc1c(C(F)(F)F)nc2c(F)cc(F)cc2c1Cl.
What is the InChIKey of 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline?
The InChIKey is HZRPNWIGHHLMDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5ClF5N/c1-4-8(12)6-2-5(13)3-7(14)9(6)18-10(4)11(15,16)17/h2-3H,1H3.
What are the key properties of 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline?
4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline has a molecular weight of 281.61 g/mol, XLogP of 4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,8-difluoro-3-methyl-2-(trifluoromethyl)quinoline is sourced from PubChem (CID 63743382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).