C11H9ClFN — CID 60994965
4-chloro-8-fluoro-2,3-dimethylquinoline (PubChem CID 60994965) has the molecular formula C11H9ClFN and a molecular weight of 209.65 g/mol. Its IUPAC name is 4-chloro-8-fluoro-2,3-dimethylquinoline.
| Compound Name | 4-chloro-8-fluoro-2,3-dimethylquinoline |
|---|---|
| PubChem CID | 60994965 |
| Molecular Formula | C11H9ClFN |
| Molecular Weight | 209.65 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 4-chloro-8-fluoro-2,3-dimethylquinoline |
| SMILES | Cc1nc2c(F)cccc2c(Cl)c1C |
| InChI | InChI=1S/C11H9ClFN/c1-6-7(2)14-11-8(10(6)12)4-3-5-9(11)13/h3-5H,1-2H3 |
| InChIKey | RAISIDMLUYCCFJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.65 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |