C12H11ClFN — CID 60996951
4-chloro-8-fluoro-2,3,5-trimethylquinoline (PubChem CID 60996951) has the molecular formula C12H11ClFN and a molecular weight of 223.68 g/mol. Its IUPAC name is 4-chloro-8-fluoro-2,3,5-trimethylquinoline.
| Compound Name | 4-chloro-8-fluoro-2,3,5-trimethylquinoline |
|---|---|
| PubChem CID | 60996951 |
| Molecular Formula | C12H11ClFN |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-chloro-8-fluoro-2,3,5-trimethylquinoline |
| SMILES | Cc1nc2c(F)ccc(C)c2c(Cl)c1C |
| InChI | InChI=1S/C12H11ClFN/c1-6-4-5-9(14)12-10(6)11(13)7(2)8(3)15-12/h4-5H,1-3H3 |
| InChIKey | BCZRSTDUYRDJJS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |