C10H9ClFN3 — CID 114693468
2-chloro-8-fluoro-N,5-dimethylquinazolin-4-amine (PubChem CID 114693468) has the molecular formula C10H9ClFN3 and a molecular weight of 225.65 g/mol. Its IUPAC name is 2-chloro-8-fluoro-N,5-dimethylquinazolin-4-amine.
| Compound Name | 2-chloro-8-fluoro-N,5-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 114693468 |
| Molecular Formula | C10H9ClFN3 |
| Molecular Weight | 225.65 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-chloro-8-fluoro-N,5-dimethylquinazolin-4-amine |
| SMILES | CNc1nc(Cl)nc2c(F)ccc(C)c12 |
| InChI | InChI=1S/C10H9ClFN3/c1-5-3-4-6(12)8-7(5)9(13-2)15-10(11)14-8/h3-4H,1-2H3,(H,13,14,15) |
| InChIKey | AFSLMHVTKFRBJU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |