C12H14FN3 — CID 62252075
(8-fluoro-2,3,5-trimethylquinolin-4-yl)hydrazine (PubChem CID 62252075) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is (8-fluoro-2,3,5-trimethylquinolin-4-yl)hydrazine.
| Compound Name | (8-fluoro-2,3,5-trimethylquinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 62252075 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (8-fluoro-2,3,5-trimethylquinolin-4-yl)hydrazine |
| SMILES | Cc1nc2c(F)ccc(C)c2c(NN)c1C |
| InChI | InChI=1S/C12H14FN3/c1-6-4-5-9(13)12-10(6)11(16-14)7(2)8(3)15-12/h4-5H,14H2,1-3H3,(H,15,16) |
| InChIKey | INDSCVLSYLCSDL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|