C13H15F2N3 — CID 62915501
(7,8-difluoro-2-methyl-3-propan-2-ylquinolin-4-yl)hydrazine (PubChem CID 62915501) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is (7,8-difluoro-2-methyl-3-propan-2-ylquinolin-4-yl)hydrazine.
| Compound Name | (7,8-difluoro-2-methyl-3-propan-2-ylquinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 62915501 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (7,8-difluoro-2-methyl-3-propan-2-ylquinolin-4-yl)hydrazine |
| SMILES | Cc1nc2c(F)c(F)ccc2c(NN)c1C(C)C |
| InChI | InChI=1S/C13H15F2N3/c1-6(2)10-7(3)17-13-8(12(10)18-16)4-5-9(14)11(13)15/h4-6H,16H2,1-3H3,(H,17,18) |
| InChIKey | DVBKVFRZMWDIIB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|