C13H14F2N2 — CID 62197895
N-ethyl-7,8-difluoro-2,3-dimethylquinolin-4-amine (PubChem CID 62197895) has the molecular formula C13H14F2N2 and a molecular weight of 236.26 g/mol. Its IUPAC name is N-ethyl-7,8-difluoro-2,3-dimethylquinolin-4-amine.
| Compound Name | N-ethyl-7,8-difluoro-2,3-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 62197895 |
| Molecular Formula | C13H14F2N2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-ethyl-7,8-difluoro-2,3-dimethylquinolin-4-amine |
| SMILES | CCNc1c(C)c(C)nc2c(F)c(F)ccc12 |
| InChI | InChI=1S/C13H14F2N2/c1-4-16-12-7(2)8(3)17-13-9(12)5-6-10(14)11(13)15/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | DRZBDWBKGBSCTC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |