C14H16F2N2 — CID 63553899
N,2-diethyl-7,8-difluoro-3-methylquinolin-4-amine (PubChem CID 63553899) has the molecular formula C14H16F2N2 and a molecular weight of 250.29 g/mol. Its IUPAC name is N,2-diethyl-7,8-difluoro-3-methylquinolin-4-amine.
| Compound Name | N,2-diethyl-7,8-difluoro-3-methylquinolin-4-amine |
|---|---|
| PubChem CID | 63553899 |
| Molecular Formula | C14H16F2N2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N,2-diethyl-7,8-difluoro-3-methylquinolin-4-amine |
| SMILES | CCNc1c(C)c(CC)nc2c(F)c(F)ccc12 |
| InChI | InChI=1S/C14H16F2N2/c1-4-11-8(3)13(17-5-2)9-6-7-10(15)12(16)14(9)18-11/h6-7H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | JFHICZIKMANMBL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |