C16H21FN2 — CID 63562434
2-ethyl-5-fluoro-3,8-dimethyl-N-propylquinolin-4-amine (PubChem CID 63562434) has the molecular formula C16H21FN2 and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-ethyl-5-fluoro-3,8-dimethyl-N-propylquinolin-4-amine.
| Compound Name | 2-ethyl-5-fluoro-3,8-dimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63562434 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-ethyl-5-fluoro-3,8-dimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C)c(CC)nc2c(C)ccc(F)c12 |
| InChI | InChI=1S/C16H21FN2/c1-5-9-18-16-11(4)13(6-2)19-15-10(3)7-8-12(17)14(15)16/h7-8H,5-6,9H2,1-4H3,(H,18,19) |
| InChIKey | WMOGGUGEYJSJTH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |