C17H24N2O — CID 63561107
2-ethyl-8-methoxy-3,5-dimethyl-N-propylquinolin-4-amine (PubChem CID 63561107) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-ethyl-8-methoxy-3,5-dimethyl-N-propylquinolin-4-amine.
| Compound Name | 2-ethyl-8-methoxy-3,5-dimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63561107 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-ethyl-8-methoxy-3,5-dimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C)c(CC)nc2c(OC)ccc(C)c12 |
| InChI | InChI=1S/C17H24N2O/c1-6-10-18-16-12(4)13(7-2)19-17-14(20-5)9-8-11(3)15(16)17/h8-9H,6-7,10H2,1-5H3,(H,18,19) |
| InChIKey | QUAUJVDWNNRBOM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |