C14H16BrIN2 — CID 114260983
8-bromo-N,2-diethyl-5-iodo-3-methylquinolin-4-amine (PubChem CID 114260983) has the molecular formula C14H16BrIN2 and a molecular weight of 419.10 g/mol. Its IUPAC name is 8-bromo-N,2-diethyl-5-iodo-3-methylquinolin-4-amine.
| Compound Name | 8-bromo-N,2-diethyl-5-iodo-3-methylquinolin-4-amine |
|---|---|
| PubChem CID | 114260983 |
| Molecular Formula | C14H16BrIN2 |
| Molecular Weight | 419.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 8-bromo-N,2-diethyl-5-iodo-3-methylquinolin-4-amine |
| SMILES | CCNc1c(C)c(CC)nc2c(Br)ccc(I)c12 |
| InChI | InChI=1S/C14H16BrIN2/c1-4-11-8(3)13(17-5-2)12-10(16)7-6-9(15)14(12)18-11/h6-7H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | WFEYDRSOERVDRH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.10 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|