C13H14Br2N2 — CID 63554447
5,8-dibromo-2-ethyl-N,3-dimethylquinolin-4-amine (PubChem CID 63554447) has the molecular formula C13H14Br2N2 and a molecular weight of 358.08 g/mol. Its IUPAC name is 5,8-dibromo-2-ethyl-N,3-dimethylquinolin-4-amine.
| Compound Name | 5,8-dibromo-2-ethyl-N,3-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 63554447 |
| Molecular Formula | C13H14Br2N2 |
| Molecular Weight | 358.08 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 5,8-dibromo-2-ethyl-N,3-dimethylquinolin-4-amine |
| SMILES | CCc1nc2c(Br)ccc(Br)c2c(NC)c1C |
| InChI | InChI=1S/C13H14Br2N2/c1-4-10-7(2)12(16-3)11-8(14)5-6-9(15)13(11)17-10/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | WCVKTDGKOKKOPI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.08 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |