C12H12Br2N2 — CID 63483840
5,8-dibromo-N,2,3-trimethylquinolin-4-amine (PubChem CID 63483840) has the molecular formula C12H12Br2N2 and a molecular weight of 344.05 g/mol. Its IUPAC name is 5,8-dibromo-N,2,3-trimethylquinolin-4-amine.
| Compound Name | 5,8-dibromo-N,2,3-trimethylquinolin-4-amine |
|---|---|
| PubChem CID | 63483840 |
| Molecular Formula | C12H12Br2N2 |
| Molecular Weight | 344.05 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 5,8-dibromo-N,2,3-trimethylquinolin-4-amine |
| SMILES | CNc1c(C)c(C)nc2c(Br)ccc(Br)c12 |
| InChI | InChI=1S/C12H12Br2N2/c1-6-7(2)16-12-9(14)5-4-8(13)10(12)11(6)15-3/h4-5H,1-3H3,(H,15,16) |
| InChIKey | GZDXYWZEYSXNLB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.05 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |