C14H16Br2N2O — CID 103416750
6,8-dibromo-3-ethyl-5-methoxy-N,2-dimethylquinolin-4-amine (PubChem CID 103416750) has the molecular formula C14H16Br2N2O and a molecular weight of 388.10 g/mol. Its IUPAC name is 6,8-dibromo-3-ethyl-5-methoxy-N,2-dimethylquinolin-4-amine.
| Compound Name | 6,8-dibromo-3-ethyl-5-methoxy-N,2-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 103416750 |
| Molecular Formula | C14H16Br2N2O |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 6,8-dibromo-3-ethyl-5-methoxy-N,2-dimethylquinolin-4-amine |
| SMILES | CCc1c(C)nc2c(Br)cc(Br)c(OC)c2c1NC |
| InChI | InChI=1S/C14H16Br2N2O/c1-5-8-7(2)18-13-9(15)6-10(16)14(19-4)11(13)12(8)17-3/h6H,5H2,1-4H3,(H,17,18) |
| InChIKey | STHAHBNZBDMASF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |