C13H14ClFN2 — CID 107531258
8-chloro-3-ethyl-5-fluoro-N,2-dimethylquinolin-4-amine (PubChem CID 107531258) has the molecular formula C13H14ClFN2 and a molecular weight of 252.72 g/mol. Its IUPAC name is 8-chloro-3-ethyl-5-fluoro-N,2-dimethylquinolin-4-amine.
| Compound Name | 8-chloro-3-ethyl-5-fluoro-N,2-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 107531258 |
| Molecular Formula | C13H14ClFN2 |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 8-chloro-3-ethyl-5-fluoro-N,2-dimethylquinolin-4-amine |
| SMILES | CCc1c(C)nc2c(Cl)ccc(F)c2c1NC |
| InChI | InChI=1S/C13H14ClFN2/c1-4-8-7(2)17-13-9(14)5-6-10(15)11(13)12(8)16-3/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | ZVBNYTNQTOFSMN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |