About 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine
8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine (PubChem CID 55197104) has the molecular formula C14H16ClFN2
and a molecular weight of 266.75 g/mol. Its IUPAC name is 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine.
Molecular Properties
| Compound Name | 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine |
| PubChem CID | 55197104 |
| Molecular Formula | C14H16ClFN2 |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine |
| SMILES | CCNc1c(CC)c(C)nc2c(Cl)cc(F)cc12 |
| InChI | InChI=1S/C14H16ClFN2/c1-4-10-8(3)18-14-11(13(10)17-5-2)6-9(16)7-12(14)15/h6-7H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | WIVVWYZKLADFRT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine?
The IUPAC name of 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine (CID 55197104) is 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine.
What is the SMILES notation for 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine?
The canonical SMILES for 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine is CCNc1c(CC)c(C)nc2c(Cl)cc(F)cc12.
What is the InChIKey of 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine?
The InChIKey is WIVVWYZKLADFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClFN2/c1-4-10-8(3)18-14-11(13(10)17-5-2)6-9(16)7-12(14)15/h6-7H,4-5H2,1-3H3,(H,17,18).
What are the key properties of 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine?
8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine has a molecular weight of 266.75 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N,3-diethyl-6-fluoro-2-methylquinolin-4-amine is sourced from PubChem (CID 55197104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).