About 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine
5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine (PubChem CID 107593975) has the molecular formula C15H18BrFN2
and a molecular weight of 325.23 g/mol. Its IUPAC name is 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine |
| PubChem CID | 107593975 |
| Molecular Formula | C15H18BrFN2 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine |
| SMILES | CCNc1c(CC)c(C)nc2c(C)cc(F)c(Br)c12 |
| InChI | InChI=1S/C15H18BrFN2/c1-5-10-9(4)19-14-8(3)7-11(17)13(16)12(14)15(10)18-6-2/h7H,5-6H2,1-4H3,(H,18,19) |
| InChIKey | JMFHZJRKEUPHGG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine?
The IUPAC name of 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine (CID 107593975) is 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine.
What is the SMILES notation for 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine?
The canonical SMILES for 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine is CCNc1c(CC)c(C)nc2c(C)cc(F)c(Br)c12.
What is the InChIKey of 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine?
The InChIKey is JMFHZJRKEUPHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrFN2/c1-5-10-9(4)19-14-8(3)7-11(17)13(16)12(14)15(10)18-6-2/h7H,5-6H2,1-4H3,(H,18,19).
What are the key properties of 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine?
5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine has a molecular weight of 325.23 g/mol, XLogP of 4.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,3-diethyl-6-fluoro-2,8-dimethylquinolin-4-amine is sourced from PubChem (CID 107593975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).